C29H27N5O — CID 6906141
1,3-diphenyl-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]pyrazole-4-carboxamide (PubChem CID 6906141) has the molecular formula C29H27N5O and a molecular weight of 461.57 g/mol. Its IUPAC name is 1,3-diphenyl-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]pyrazole-4-carboxamide.
| Compound Name | 1,3-diphenyl-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 6906141 |
| Molecular Formula | C29H27N5O |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 1,3-diphenyl-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]pyrazole-4-carboxamide |
| SMILES | CN1/C(=C\C=N\NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C29H27N5O/c1-29(2)24-16-10-11-17-25(24)33(3)26(29)18-19-30-31-28(35)23-20-34(22-14-8-5-9-15-22)32-27(23)21-12-6-4-7-13-21/h4-20H,1-3H3,(H,31,35)/b26-18-,30-19+ |
| InChIKey | ZAECHMXFBNWFJU-QILYSCSISA-N |
| XLogP | 5.57 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|