C24H21N3O — CID 19281305
N-(2,5-dimethylphenyl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 19281305) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19281305 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)c1 |
| InChI | InChI=1S/C24H21N3O/c1-17-13-14-18(2)22(15-17)25-24(28)21-16-27(20-11-7-4-8-12-20)26-23(21)19-9-5-3-6-10-19/h3-16H,1-2H3,(H,25,28) |
| InChIKey | WKQHSVZWFUGFHC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |