C28H30N5O+ — CID 2475126
N-[2-methyl-4-(4-methylpiperazin-4-ium-1-yl)phenyl]-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 2475126) has the molecular formula C28H30N5O+ and a molecular weight of 452.58 g/mol. Its IUPAC name is N-[2-methyl-4-(4-methylpiperazin-4-ium-1-yl)phenyl]-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-[2-methyl-4-(4-methylpiperazin-4-ium-1-yl)phenyl]-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 2475126 |
| Molecular Formula | C28H30N5O+ |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | N-[2-methyl-4-(4-methylpiperazin-4-ium-1-yl)phenyl]-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | Cc1cc(N2CC[NH+](C)CC2)ccc1NC(=O)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H29N5O/c1-21-19-24(32-17-15-31(2)16-18-32)13-14-26(21)29-28(34)25-20-33(23-11-7-4-8-12-23)30-27(25)22-9-5-3-6-10-22/h3-14,19-20H,15-18H2,1-2H3,(H,29,34)/p+1 |
| InChIKey | ZTOSOPGLCYNLEQ-UHFFFAOYSA-O |
| XLogP | 3.43 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|