C21H24N5O+ — CID 9204821
N-(4-methylpiperazin-4-ium-1-yl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 9204821) has the molecular formula C21H24N5O+ and a molecular weight of 362.46 g/mol. Its IUPAC name is N-(4-methylpiperazin-4-ium-1-yl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(4-methylpiperazin-4-ium-1-yl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 9204821 |
| Molecular Formula | C21H24N5O+ |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-(4-methylpiperazin-4-ium-1-yl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | C[NH+]1CCN(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N5O/c1-24-12-14-25(15-13-24)23-21(27)19-16-26(18-10-6-3-7-11-18)22-20(19)17-8-4-2-5-9-17/h2-11,16H,12-15H2,1H3,(H,23,27)/p+1 |
| InChIKey | PPPODRKAXVRKNG-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |