C18H17FN4O — CID 9163796
3-(4-fluorophenyl)-N',N'-dimethyl-1-phenylpyrazole-4-carbohydrazide (PubChem CID 9163796) has the molecular formula C18H17FN4O and a molecular weight of 324.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N',N'-dimethyl-1-phenylpyrazole-4-carbohydrazide.
| Compound Name | 3-(4-fluorophenyl)-N',N'-dimethyl-1-phenylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9163796 |
| Molecular Formula | C18H17FN4O |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N',N'-dimethyl-1-phenylpyrazole-4-carbohydrazide |
| SMILES | CN(C)NC(=O)c1cn(-c2ccccc2)nc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN4O/c1-22(2)21-18(24)16-12-23(15-6-4-3-5-7-15)20-17(16)13-8-10-14(19)11-9-13/h3-12H,1-2H3,(H,21,24) |
| InChIKey | KEEQMVRKCVDZSU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|