C24H21FN4O3 — CID 26247367
N'-(2,5-dimethylfuran-3-carbonyl)-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carbohydrazide (PubChem CID 26247367) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is N'-(2,5-dimethylfuran-3-carbonyl)-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carbohydrazide.
| Compound Name | N'-(2,5-dimethylfuran-3-carbonyl)-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 26247367 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N'-(2,5-dimethylfuran-3-carbonyl)-1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carbohydrazide |
| SMILES | Cc1ccc(-c2nn(-c3ccc(F)cc3)cc2C(=O)NNC(=O)c2cc(C)oc2C)cc1 |
| InChI | InChI=1S/C24H21FN4O3/c1-14-4-6-17(7-5-14)22-21(13-29(28-22)19-10-8-18(25)9-11-19)24(31)27-26-23(30)20-12-15(2)32-16(20)3/h4-13H,1-3H3,(H,26,30)(H,27,31) |
| InChIKey | PIWUCUXTYHQNOY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|