C20H18FN3O3 — CID 7726927
[2-(methylamino)-2-oxoethyl] 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate (PubChem CID 7726927) has the molecular formula C20H18FN3O3 and a molecular weight of 367.38 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 7726927 |
| Molecular Formula | C20H18FN3O3 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate |
| SMILES | CNC(=O)COC(=O)c1cn(-c2ccc(F)cc2)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C20H18FN3O3/c1-13-3-5-14(6-4-13)19-17(20(26)27-12-18(25)22-2)11-24(23-19)16-9-7-15(21)8-10-16/h3-11H,12H2,1-2H3,(H,22,25) |
| InChIKey | CTAYVHIQOKNYRY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |