C19H16FN3O3 — CID 7726954
(2-amino-2-oxoethyl) 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate (PubChem CID 7726954) has the molecular formula C19H16FN3O3 and a molecular weight of 353.35 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 7726954 |
| Molecular Formula | C19H16FN3O3 |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (2-amino-2-oxoethyl) 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate |
| SMILES | Cc1ccc(-c2nn(-c3ccc(F)cc3)cc2C(=O)OCC(N)=O)cc1 |
| InChI | InChI=1S/C19H16FN3O3/c1-12-2-4-13(5-3-12)18-16(19(25)26-11-17(21)24)10-23(22-18)15-8-6-14(20)7-9-15/h2-10H,11H2,1H3,(H2,21,24) |
| InChIKey | YYXBNMUWZPLDFY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |