C22H19FN4O3 — CID 7726911
[2-(2-cyanoethylamino)-2-oxoethyl] 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate (PubChem CID 7726911) has the molecular formula C22H19FN4O3 and a molecular weight of 406.42 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 7726911 |
| Molecular Formula | C22H19FN4O3 |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] 1-(4-fluorophenyl)-3-(4-methylphenyl)pyrazole-4-carboxylate |
| SMILES | Cc1ccc(-c2nn(-c3ccc(F)cc3)cc2C(=O)OCC(=O)NCCC#N)cc1 |
| InChI | InChI=1S/C22H19FN4O3/c1-15-3-5-16(6-4-15)21-19(22(29)30-14-20(28)25-12-2-11-24)13-27(26-21)18-9-7-17(23)8-10-18/h3-10,13H,2,12,14H2,1H3,(H,25,28) |
| InChIKey | HEGDTWVQZBLVBN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|