C26H25N3O — CID 7914296
N-(4-tert-butylphenyl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 7914296) has the molecular formula C26H25N3O and a molecular weight of 395.51 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 7914296 |
| Molecular Formula | C26H25N3O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-(4-tert-butylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O/c1-26(2,3)20-14-16-21(17-15-20)27-25(30)23-18-29(22-12-8-5-9-13-22)28-24(23)19-10-6-4-7-11-19/h4-18H,1-3H3,(H,27,30) |
| InChIKey | FLZMPHNLPCFCNI-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |