C24H20ClN3O3 — CID 26210602
N-(5-chloro-2,4-dimethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 26210602) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 26210602 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)cc1Cl |
| InChI | InChI=1S/C24H20ClN3O3/c1-30-21-14-22(31-2)20(13-19(21)25)26-24(29)18-15-28(17-11-7-4-8-12-17)27-23(18)16-9-5-3-6-10-16/h3-15H,1-2H3,(H,26,29) |
| InChIKey | VXOBTLYNPLHHIU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |