C26H24N4O2 — CID 17482398
N-(2-morpholin-4-ylphenyl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 17482398) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-(2-morpholin-4-ylphenyl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(2-morpholin-4-ylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 17482398 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-(2-morpholin-4-ylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H24N4O2/c31-26(27-23-13-7-8-14-24(23)29-15-17-32-18-16-29)22-19-30(21-11-5-2-6-12-21)28-25(22)20-9-3-1-4-10-20/h1-14,19H,15-18H2,(H,27,31) |
| InChIKey | YZLSCTYLZWHGPG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |