C26H23FN4O2 — CID 56500113
N-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 56500113) has the molecular formula C26H23FN4O2 and a molecular weight of 442.49 g/mol. Its IUPAC name is N-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 56500113 |
| Molecular Formula | C26H23FN4O2 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)c(F)c1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C26H23FN4O2/c27-23-17-20(11-12-24(23)30-13-15-33-16-14-30)28-26(32)22-18-31(21-9-5-2-6-10-21)29-25(22)19-7-3-1-4-8-19/h1-12,17-18H,13-16H2,(H,28,32) |
| InChIKey | JFAOJBGMFCHSQQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|