C25H21ClN4O2 — CID 56580220
N-(4-acetamido-2-chlorophenyl)-3-(3-methylphenyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 56580220) has the molecular formula C25H21ClN4O2 and a molecular weight of 444.92 g/mol. Its IUPAC name is N-(4-acetamido-2-chlorophenyl)-3-(3-methylphenyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-(4-acetamido-2-chlorophenyl)-3-(3-methylphenyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 56580220 |
| Molecular Formula | C25H21ClN4O2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-(4-acetamido-2-chlorophenyl)-3-(3-methylphenyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cn(-c3ccccc3)nc2-c2cccc(C)c2)c(Cl)c1 |
| InChI | InChI=1S/C25H21ClN4O2/c1-16-7-6-8-18(13-16)24-21(15-30(29-24)20-9-4-3-5-10-20)25(32)28-23-12-11-19(14-22(23)26)27-17(2)31/h3-15H,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | IDLLMQJRBFMSST-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |