C21H16N4OS — CID 7929589
1,3-diphenyl-N-[(Z)-thiophen-2-ylmethylideneamino]pyrazole-4-carboxamide (PubChem CID 7929589) has the molecular formula C21H16N4OS and a molecular weight of 372.45 g/mol. Its IUPAC name is 1,3-diphenyl-N-[(Z)-thiophen-2-ylmethylideneamino]pyrazole-4-carboxamide.
| Compound Name | 1,3-diphenyl-N-[(Z)-thiophen-2-ylmethylideneamino]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 7929589 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1,3-diphenyl-N-[(Z)-thiophen-2-ylmethylideneamino]pyrazole-4-carboxamide |
| SMILES | O=C(N/N=C\c1cccs1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H16N4OS/c26-21(23-22-14-18-12-7-13-27-18)19-15-25(17-10-5-2-6-11-17)24-20(19)16-8-3-1-4-9-16/h1-15H,(H,23,26)/b22-14- |
| InChIKey | NEQBWZJTKRHIBF-HMAPJEAMSA-N |
| XLogP | 4.36 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|