C26H24N4O3 — CID 18269191
N-[(E)-(4-ethoxy-3-methoxyphenyl)methylideneamino]-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 18269191) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[(E)-(4-ethoxy-3-methoxyphenyl)methylideneamino]-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-[(E)-(4-ethoxy-3-methoxyphenyl)methylideneamino]-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18269191 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[(E)-(4-ethoxy-3-methoxyphenyl)methylideneamino]-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)c2cn(-c3ccccc3)nc2-c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H24N4O3/c1-3-33-23-15-14-19(16-24(23)32-2)17-27-28-26(31)22-18-30(21-12-8-5-9-13-21)29-25(22)20-10-6-4-7-11-20/h4-18H,3H2,1-2H3,(H,28,31)/b27-17+ |
| InChIKey | HFWSHGYCBUQMII-WPWMEQJKSA-N |
| XLogP | 4.71 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|