C26H25N5OS — CID 6902021
3-methyl-1-phenyl-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 6902021) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is 3-methyl-1-phenyl-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 3-methyl-1-phenyl-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6902021 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 3-methyl-1-phenyl-N-[(E)-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]amino]thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)N/N=C/C=C3\N(C)c4ccccc4C3(C)C)cc12 |
| InChI | InChI=1S/C26H25N5OS/c1-17-19-16-22(33-25(19)31(29-17)18-10-6-5-7-11-18)24(32)28-27-15-14-23-26(2,3)20-12-8-9-13-21(20)30(23)4/h5-16H,1-4H3,(H,28,32)/b23-14-,27-15+ |
| InChIKey | ZOKWXDRDOGZXDF-ZQPJOMHKSA-N |
| XLogP | 5.42 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|