C26H22N2O — CID 101199233
10-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]iminophenanthren-9-one (PubChem CID 101199233) has the molecular formula C26H22N2O and a molecular weight of 378.48 g/mol. Its IUPAC name is 10-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]iminophenanthren-9-one.
| Compound Name | 10-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]iminophenanthren-9-one |
|---|---|
| PubChem CID | 101199233 |
| Molecular Formula | C26H22N2O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 10-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]iminophenanthren-9-one |
| SMILES | CN1/C(=C\N=C2/C(=O)c3ccccc3-c3ccccc32)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C26H22N2O/c1-26(2)21-14-8-9-15-22(21)28(3)23(26)16-27-24-19-12-6-4-10-17(19)18-11-5-7-13-20(18)25(24)29/h4-16H,1-3H3/b23-16-,27-24- |
| InChIKey | MZPILJSBTCQOOC-SNJXSLKZSA-N |
| XLogP | 5.61 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|