C20H22N2O3 — CID 162462615
5-(hydroxymethyl)-3-methoxy-6-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]iminocyclohexa-2,4-dien-1-one (PubChem CID 162462615) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3-methoxy-6-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]iminocyclohexa-2,4-dien-1-one.
| Compound Name | 5-(hydroxymethyl)-3-methoxy-6-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]iminocyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 162462615 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 5-(hydroxymethyl)-3-methoxy-6-[(E)-(1,3,3-trimethylindol-2-ylidene)methyl]iminocyclohexa-2,4-dien-1-one |
| SMILES | COC1=CC(=O)/C(=N/C=C2/N(C)c3ccccc3C2(C)C)C(CO)=C1 |
| InChI | InChI=1S/C20H22N2O3/c1-20(2)15-7-5-6-8-16(15)22(3)18(20)11-21-19-13(12-23)9-14(25-4)10-17(19)24/h5-11,23H,12H2,1-4H3/b18-11+,21-19+ |
| InChIKey | FNHQFKCNEFYNDF-BEHKCWOLSA-N |
| XLogP | 2.73 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|