C18H14F3NO2 — CID 59962825
2,3,5-trifluoro-6-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 59962825) has the molecular formula C18H14F3NO2 and a molecular weight of 333.31 g/mol. Its IUPAC name is 2,3,5-trifluoro-6-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3,5-trifluoro-6-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 59962825 |
| Molecular Formula | C18H14F3NO2 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2,3,5-trifluoro-6-[(Z)-(1,3,3-trimethylindol-2-ylidene)methyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CN1/C(=C\C2=C(F)C(=O)C(F)=C(F)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C18H14F3NO2/c1-18(2)10-6-4-5-7-11(10)22(3)12(18)8-9-13(19)17(24)15(21)14(20)16(9)23/h4-8H,1-3H3/b12-8- |
| InChIKey | YRVUKAWHIMPEDR-WQLSENKSSA-N |
| XLogP | 3.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|