C20H20F2N2S2 — CID 2337318
(2Z)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide (PubChem CID 2337318) has the molecular formula C20H20F2N2S2 and a molecular weight of 390.52 g/mol. Its IUPAC name is (2Z)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide.
| Compound Name | (2Z)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide |
|---|---|
| PubChem CID | 2337318 |
| Molecular Formula | C20H20F2N2S2 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (2Z)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(1,3,3-trimethylindol-2-ylidene)ethanethioamide |
| SMILES | CN1/C(=C\C(=S)Nc2ccc(SC(F)F)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H20F2N2S2/c1-20(2)15-6-4-5-7-16(15)24(3)17(20)12-18(25)23-13-8-10-14(11-9-13)26-19(21)22/h4-12,19H,1-3H3,(H,23,25)/b17-12- |
| InChIKey | MIRPCVABSLEFHJ-ATVHPVEESA-N |
| XLogP | 6.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|