C15H18N2O2 — CID 2330522
(4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butanamide (PubChem CID 2330522) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butanamide.
| Compound Name | (4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butanamide |
|---|---|
| PubChem CID | 2330522 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (4E)-3-oxo-4-(1,3,3-trimethylindol-2-ylidene)butanamide |
| SMILES | CN1/C(=C/C(=O)CC(N)=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H18N2O2/c1-15(2)11-6-4-5-7-12(11)17(3)13(15)8-10(18)9-14(16)19/h4-8H,9H2,1-3H3,(H2,16,19)/b13-8+ |
| InChIKey | DCJADGFCADXFBX-MDWZMJQESA-N |
| XLogP | 1.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|