C19H25N5O — CID 134041669
(3E)-1-(5-tert-butyltetrazol-1-yl)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one (PubChem CID 134041669) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is (3E)-1-(5-tert-butyltetrazol-1-yl)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one.
| Compound Name | (3E)-1-(5-tert-butyltetrazol-1-yl)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 134041669 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (3E)-1-(5-tert-butyltetrazol-1-yl)-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
| SMILES | CN1/C(=C/C(=O)Cn2nnnc2C(C)(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H25N5O/c1-18(2,3)17-20-21-22-24(17)12-13(25)11-16-19(4,5)14-9-7-8-10-15(14)23(16)6/h7-11H,12H2,1-6H3/b16-11+ |
| InChIKey | SKTLTQQQTHZWIS-LFIBNONCSA-N |
| XLogP | 2.85 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|