C20H27N3O2 — CID 56542596
3,3-dimethyl-4-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]piperazin-2-one (PubChem CID 56542596) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 3,3-dimethyl-4-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]piperazin-2-one.
| Compound Name | 3,3-dimethyl-4-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]piperazin-2-one |
|---|---|
| PubChem CID | 56542596 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 3,3-dimethyl-4-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]piperazin-2-one |
| SMILES | CN1/C(=C\C(=O)CN2CCNC(=O)C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H27N3O2/c1-19(2)15-8-6-7-9-16(15)22(5)17(19)12-14(24)13-23-11-10-21-18(25)20(23,3)4/h6-9,12H,10-11,13H2,1-5H3,(H,21,25)/b17-12- |
| InChIKey | XSGFVCOZIWBHFH-ATVHPVEESA-N |
| XLogP | 2.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|