C22H30N2O3 — CID 2999198
ethyl 1-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]piperidine-3-carboxylate (PubChem CID 2999198) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is ethyl 1-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 2999198 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | ethyl 1-[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(CC(=O)C=C2N(C)c3ccccc3C2(C)C)C1 |
| InChI | InChI=1S/C22H30N2O3/c1-5-27-21(26)16-9-8-12-24(14-16)15-17(25)13-20-22(2,3)18-10-6-7-11-19(18)23(20)4/h6-7,10-11,13,16H,5,8-9,12,14-15H2,1-4H3 |
| InChIKey | PESPVVDTHYZOHB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|