C26H33N3O — CID 34943216
(3Z)-1-[4-(2-phenylethyl)piperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one (PubChem CID 34943216) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is (3Z)-1-[4-(2-phenylethyl)piperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one.
| Compound Name | (3Z)-1-[4-(2-phenylethyl)piperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 34943216 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | (3Z)-1-[4-(2-phenylethyl)piperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
| SMILES | CN1/C(=C\C(=O)CN2CCN(CCc3ccccc3)CC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C26H33N3O/c1-26(2)23-11-7-8-12-24(23)27(3)25(26)19-22(30)20-29-17-15-28(16-18-29)14-13-21-9-5-4-6-10-21/h4-12,19H,13-18,20H2,1-3H3/b25-19- |
| InChIKey | BVXDCUXZVAHGTE-PLRJNAJWSA-N |
| XLogP | 3.73 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|