C24H28N4O5S — CID 98630277
(3E)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one (PubChem CID 98630277) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is (3E)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one.
| Compound Name | (3E)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
|---|---|
| PubChem CID | 98630277 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | (3E)-1-[4-(3-nitrophenyl)sulfonylpiperazin-1-yl]-3-(1,3,3-trimethylindol-2-ylidene)propan-2-one |
| SMILES | CN1/C(=C/C(=O)CN2CCN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)CC2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H28N4O5S/c1-24(2)21-9-4-5-10-22(21)25(3)23(24)16-19(29)17-26-11-13-27(14-12-26)34(32,33)20-8-6-7-18(15-20)28(30)31/h4-10,15-16H,11-14,17H2,1-3H3/b23-16+ |
| InChIKey | JUHHPRLDQWUDKZ-XQNSMLJCSA-N |
| XLogP | 2.78 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|