C24H24ClN3O3 — CID 51872992
(5R)-5-(4-chlorophenyl)-5-methyl-3-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidine-2,4-dione (PubChem CID 51872992) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is (5R)-5-(4-chlorophenyl)-5-methyl-3-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(4-chlorophenyl)-5-methyl-3-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51872992 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (5R)-5-(4-chlorophenyl)-5-methyl-3-[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl]imidazolidine-2,4-dione |
| SMILES | CN1/C(=C\C(=O)CN2C(=O)N[C@](C)(c3ccc(Cl)cc3)C2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H24ClN3O3/c1-23(2)18-7-5-6-8-19(18)27(4)20(23)13-17(29)14-28-21(30)24(3,26-22(28)31)15-9-11-16(25)12-10-15/h5-13H,14H2,1-4H3,(H,26,31)/b20-13-/t24-/m1/s1 |
| InChIKey | GIJVFVOBIYBLKD-VGTKIRILSA-N |
| XLogP | 3.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|