C19H17Cl2NO — CID 2337442
(2E)-1-(2,4-dichlorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone (PubChem CID 2337442) has the molecular formula C19H17Cl2NO and a molecular weight of 346.26 g/mol. Its IUPAC name is (2E)-1-(2,4-dichlorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone.
| Compound Name | (2E)-1-(2,4-dichlorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone |
|---|---|
| PubChem CID | 2337442 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (2E)-1-(2,4-dichlorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone |
| SMILES | CN1/C(=C/C(=O)c2ccc(Cl)cc2Cl)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H17Cl2NO/c1-19(2)14-6-4-5-7-16(14)22(3)18(19)11-17(23)13-9-8-12(20)10-15(13)21/h4-11H,1-3H3/b18-11+ |
| InChIKey | LKHDNTGUFQINBR-WOJGMQOQSA-N |
| XLogP | 5.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|