C24H25Cl2NO4 — CID 3948455
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 3948455) has the molecular formula C24H25Cl2NO4 and a molecular weight of 462.37 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 3948455 |
| Molecular Formula | C24H25Cl2NO4 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | CN1C(=CC(=O)COC(=O)CCCOc2ccc(Cl)cc2Cl)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H25Cl2NO4/c1-24(2)18-7-4-5-8-20(18)27(3)22(24)14-17(28)15-31-23(29)9-6-12-30-21-11-10-16(25)13-19(21)26/h4-5,7-8,10-11,13-14H,6,9,12,15H2,1-3H3 |
| InChIKey | WWIFULFTQWUCSG-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|