C24H23Cl2N3O6 — CID 16540903
[2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate (PubChem CID 16540903) has the molecular formula C24H23Cl2N3O6 and a molecular weight of 520.37 g/mol. Its IUPAC name is [2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate.
| Compound Name | [2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
|---|---|
| PubChem CID | 16540903 |
| Molecular Formula | C24H23Cl2N3O6 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | [2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 4-(2,4-dichlorophenoxy)butanoate |
| SMILES | Cn1c(=O)c(C(=O)COC(=O)CCCOc2ccc(Cl)cc2Cl)c(N)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C24H23Cl2N3O6/c1-28-23(32)21(22(27)29(24(28)33)13-15-6-3-2-4-7-15)18(30)14-35-20(31)8-5-11-34-19-10-9-16(25)12-17(19)26/h2-4,6-7,9-10,12H,5,8,11,13-14,27H2,1H3 |
| InChIKey | YNTNQQVIFXNTBU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|