C21H17ClN4O7 — CID 3882676
[2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 5-chloro-2-nitrobenzoate (PubChem CID 3882676) has the molecular formula C21H17ClN4O7 and a molecular weight of 472.84 g/mol. Its IUPAC name is [2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 3882676 |
| Molecular Formula | C21H17ClN4O7 |
| Molecular Weight | 472.84 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | [2-(6-amino-1-benzyl-3-methyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl] 5-chloro-2-nitrobenzoate |
| SMILES | Cn1c(=O)c(C(=O)COC(=O)c2cc(Cl)ccc2[N+](=O)[O-])c(N)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C21H17ClN4O7/c1-24-19(28)17(18(23)25(21(24)30)10-12-5-3-2-4-6-12)16(27)11-33-20(29)14-9-13(22)7-8-15(14)26(31)32/h2-9H,10-11,23H2,1H3 |
| InChIKey | FQPZYCJWHFTHMR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.84 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|