C22H21Cl2NO4 — CID 3377126
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 3377126) has the molecular formula C22H21Cl2NO4 and a molecular weight of 434.32 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 3377126 |
| Molecular Formula | C22H21Cl2NO4 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | CN1C(=CC(=O)COC(=O)COc2ccc(Cl)cc2Cl)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H21Cl2NO4/c1-22(2)16-6-4-5-7-18(16)25(3)20(22)11-15(26)12-29-21(27)13-28-19-9-8-14(23)10-17(19)24/h4-11H,12-13H2,1-3H3 |
| InChIKey | UWGXDWBLTWBXMY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|