C23H22N2O4 — CID 55404753
[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1,2-benzoxazol-3-yl)acetate (PubChem CID 55404753) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1,2-benzoxazol-3-yl)acetate.
| Compound Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1,2-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 55404753 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1,2-benzoxazol-3-yl)acetate |
| SMILES | CN1/C(=C\C(=O)COC(=O)Cc2noc3ccccc23)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C23H22N2O4/c1-23(2)17-9-5-6-10-19(17)25(3)21(23)12-15(26)14-28-22(27)13-18-16-8-4-7-11-20(16)29-24-18/h4-12H,13-14H2,1-3H3/b21-12- |
| InChIKey | SBQCACXGFXAVPF-MTJSOVHGSA-N |
| XLogP | 3.79 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|