C24H24N2O3 — CID 98416141
[(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1H-indol-3-yl)acetate (PubChem CID 98416141) has the molecular formula C24H24N2O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 98416141 |
| Molecular Formula | C24H24N2O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-(1H-indol-3-yl)acetate |
| SMILES | CN1/C(=C/C(=O)COC(=O)Cc2c[nH]c3ccccc23)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H24N2O3/c1-24(2)19-9-5-7-11-21(19)26(3)22(24)13-17(27)15-29-23(28)12-16-14-25-20-10-6-4-8-18(16)20/h4-11,13-14,25H,12,15H2,1-3H3/b22-13+ |
| InChIKey | BZVRBBWBTUGOKC-LPYMAVHISA-N |
| XLogP | 4.13 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|