C29H25NO5 — CID 3653366
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(2-oxo-2-phenylacetyl)benzoate (PubChem CID 3653366) has the molecular formula C29H25NO5 and a molecular weight of 467.52 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(2-oxo-2-phenylacetyl)benzoate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(2-oxo-2-phenylacetyl)benzoate |
|---|---|
| PubChem CID | 3653366 |
| Molecular Formula | C29H25NO5 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(2-oxo-2-phenylacetyl)benzoate |
| SMILES | CN1C(=CC(=O)COC(=O)c2ccc(C(=O)C(=O)c3ccccc3)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C29H25NO5/c1-29(2)23-11-7-8-12-24(23)30(3)25(29)17-22(31)18-35-28(34)21-15-13-20(14-16-21)27(33)26(32)19-9-5-4-6-10-19/h4-17H,18H2,1-3H3 |
| InChIKey | QSKNUBHYZFKXLI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|