C22H21N3O3 — CID 36508640
[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 1H-indazole-5-carboxylate (PubChem CID 36508640) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 1H-indazole-5-carboxylate.
| Compound Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 1H-indazole-5-carboxylate |
|---|---|
| PubChem CID | 36508640 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 1H-indazole-5-carboxylate |
| SMILES | CN1/C(=C\C(=O)COC(=O)c2ccc3[nH]ncc3c2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H21N3O3/c1-22(2)17-6-4-5-7-19(17)25(3)20(22)11-16(26)13-28-21(27)14-8-9-18-15(10-14)12-23-24-18/h4-12H,13H2,1-3H3,(H,23,24)/b20-11- |
| InChIKey | UFAHHNVZFDOECF-JAIQZWGSSA-N |
| XLogP | 3.60 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|