C23H25NO5S — CID 42979673
[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(methylsulfonylmethyl)benzoate (PubChem CID 42979673) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(methylsulfonylmethyl)benzoate.
| Compound Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(methylsulfonylmethyl)benzoate |
|---|---|
| PubChem CID | 42979673 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-(methylsulfonylmethyl)benzoate |
| SMILES | CN1/C(=C\C(=O)COC(=O)c2ccc(CS(C)(=O)=O)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C23H25NO5S/c1-23(2)19-7-5-6-8-20(19)24(3)21(23)13-18(25)14-29-22(26)17-11-9-16(10-12-17)15-30(4,27)28/h5-13H,14-15H2,1-4H3/b21-13- |
| InChIKey | CPNPDBXZBDQCPW-BKUYFWCQSA-N |
| XLogP | 3.27 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|