C28H27ClN2O5S — CID 2413419
[(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-(benzylsulfamoyl)-4-chlorobenzoate (PubChem CID 2413419) has the molecular formula C28H27ClN2O5S and a molecular weight of 539.05 g/mol. Its IUPAC name is [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-(benzylsulfamoyl)-4-chlorobenzoate.
| Compound Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-(benzylsulfamoyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 2413419 |
| Molecular Formula | C28H27ClN2O5S |
| Molecular Weight | 539.05 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | [(3Z)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-(benzylsulfamoyl)-4-chlorobenzoate |
| SMILES | CN1/C(=C\C(=O)COC(=O)c2ccc(Cl)c(S(=O)(=O)NCc3ccccc3)c2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C28H27ClN2O5S/c1-28(2)22-11-7-8-12-24(22)31(3)26(28)16-21(32)18-36-27(33)20-13-14-23(29)25(15-20)37(34,35)30-17-19-9-5-4-6-10-19/h4-16,30H,17-18H2,1-3H3/b26-16- |
| InChIKey | OBBBKOICWAOUIL-QQXSKIMKSA-N |
| XLogP | 4.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.05 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|