C26H25ClN2O4S — CID 2318749
2-chloro-N-(4-methoxyphenyl)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide (PubChem CID 2318749) has the molecular formula C26H25ClN2O4S and a molecular weight of 497.02 g/mol. Its IUPAC name is 2-chloro-N-(4-methoxyphenyl)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide.
| Compound Name | 2-chloro-N-(4-methoxyphenyl)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2318749 |
| Molecular Formula | C26H25ClN2O4S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-chloro-N-(4-methoxyphenyl)-5-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(C(=O)/C=C3\N(C)c4ccccc4C3(C)C)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H25ClN2O4S/c1-26(2)20-7-5-6-8-22(20)29(3)25(26)16-23(30)17-9-14-21(27)24(15-17)34(31,32)28-18-10-12-19(33-4)13-11-18/h5-16,28H,1-4H3/b25-16- |
| InChIKey | BSIWPAHDNUYXGT-XYGWBWBKSA-N |
| XLogP | 5.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|