C20H16ClFN2O4S — CID 27228973
4-chloro-3-[(4-fluorophenyl)sulfamoyl]-N-(4-methoxyphenyl)benzamide (PubChem CID 27228973) has the molecular formula C20H16ClFN2O4S and a molecular weight of 434.88 g/mol. Its IUPAC name is 4-chloro-3-[(4-fluorophenyl)sulfamoyl]-N-(4-methoxyphenyl)benzamide.
| Compound Name | 4-chloro-3-[(4-fluorophenyl)sulfamoyl]-N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 27228973 |
| Molecular Formula | C20H16ClFN2O4S |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 4-chloro-3-[(4-fluorophenyl)sulfamoyl]-N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)Nc3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C20H16ClFN2O4S/c1-28-17-9-7-15(8-10-17)23-20(25)13-2-11-18(21)19(12-13)29(26,27)24-16-5-3-14(22)4-6-16/h2-12,24H,1H3,(H,23,25) |
| InChIKey | WAVUBNSFVHHDMD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |