C22H20Cl2N2O5S — CID 55959975
4-chloro-3-[(4-chlorophenyl)sulfamoyl]-N-[3-(2-methoxyethoxy)phenyl]benzamide (PubChem CID 55959975) has the molecular formula C22H20Cl2N2O5S and a molecular weight of 495.38 g/mol. Its IUPAC name is 4-chloro-3-[(4-chlorophenyl)sulfamoyl]-N-[3-(2-methoxyethoxy)phenyl]benzamide.
| Compound Name | 4-chloro-3-[(4-chlorophenyl)sulfamoyl]-N-[3-(2-methoxyethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 55959975 |
| Molecular Formula | C22H20Cl2N2O5S |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 4-chloro-3-[(4-chlorophenyl)sulfamoyl]-N-[3-(2-methoxyethoxy)phenyl]benzamide |
| SMILES | COCCOc1cccc(NC(=O)c2ccc(Cl)c(S(=O)(=O)Nc3ccc(Cl)cc3)c2)c1 |
| InChI | InChI=1S/C22H20Cl2N2O5S/c1-30-11-12-31-19-4-2-3-18(14-19)25-22(27)15-5-10-20(24)21(13-15)32(28,29)26-17-8-6-16(23)7-9-17/h2-10,13-14,26H,11-12H2,1H3,(H,25,27) |
| InChIKey | KEQCKIALYLUWON-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|