C25H23ClN2O3S — CID 4305840
N-(4-chlorophenyl)-4-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide (PubChem CID 4305840) has the molecular formula C25H23ClN2O3S and a molecular weight of 466.99 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide.
| Compound Name | N-(4-chlorophenyl)-4-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4305840 |
| Molecular Formula | C25H23ClN2O3S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | N-(4-chlorophenyl)-4-[2-(1,3,3-trimethylindol-2-ylidene)acetyl]benzenesulfonamide |
| SMILES | CN1C(=CC(=O)c2ccc(S(=O)(=O)Nc3ccc(Cl)cc3)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H23ClN2O3S/c1-25(2)21-6-4-5-7-22(21)28(3)24(25)16-23(29)17-8-14-20(15-9-17)32(30,31)27-19-12-10-18(26)11-13-19/h4-16,27H,1-3H3 |
| InChIKey | UVTGJXCCFZYKHZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|