C21H19ClFNO3 — CID 2091913
[(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-chloro-4-fluorobenzoate (PubChem CID 2091913) has the molecular formula C21H19ClFNO3 and a molecular weight of 387.84 g/mol. Its IUPAC name is [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-chloro-4-fluorobenzoate.
| Compound Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 2091913 |
| Molecular Formula | C21H19ClFNO3 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-chloro-4-fluorobenzoate |
| SMILES | CN1/C(=C/C(=O)COC(=O)c2ccc(F)cc2Cl)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C21H19ClFNO3/c1-21(2)16-6-4-5-7-18(16)24(3)19(21)11-14(25)12-27-20(26)15-9-8-13(23)10-17(15)22/h4-11H,12H2,1-3H3/b19-11+ |
| InChIKey | LOMYHYVTOVUABK-YBFXNURJSA-N |
| XLogP | 4.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|