C21H20INO3 — CID 2425199
[(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-iodobenzoate (PubChem CID 2425199) has the molecular formula C21H20INO3 and a molecular weight of 461.30 g/mol. Its IUPAC name is [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-iodobenzoate.
| Compound Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 2425199 |
| Molecular Formula | C21H20INO3 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-iodobenzoate |
| SMILES | CN1/C(=C/C(=O)COC(=O)c2ccccc2I)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C21H20INO3/c1-21(2)16-9-5-7-11-18(16)23(3)19(21)12-14(24)13-26-20(25)15-8-4-6-10-17(15)22/h4-12H,13H2,1-3H3/b19-12+ |
| InChIKey | NAKYXRBIDZBXJE-XDHOZWIPSA-N |
| XLogP | 4.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|