C19H20N2O4 — CID 7603091
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methyl-1,2-oxazole-5-carboxylate (PubChem CID 7603091) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methyl-1,2-oxazole-5-carboxylate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methyl-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 7603091 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methyl-1,2-oxazole-5-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)C=C2N(C)c3ccccc3C2(C)C)on1 |
| InChI | InChI=1S/C19H20N2O4/c1-12-9-16(25-20-12)18(23)24-11-13(22)10-17-19(2,3)14-7-5-6-8-15(14)21(17)4/h5-10H,11H2,1-4H3 |
| InChIKey | VRHOLJNBICZRFQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|