C23H25NO4 — CID 7668993
[(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-ethoxybenzoate (PubChem CID 7668993) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-ethoxybenzoate.
| Compound Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 7668993 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)OCC(=O)/C=C1/N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C23H25NO4/c1-5-27-20-13-9-6-10-17(20)22(26)28-15-16(25)14-21-23(2,3)18-11-7-8-12-19(18)24(21)4/h6-14H,5,15H2,1-4H3/b21-14+ |
| InChIKey | MCOWNFGPHVRMJU-KGENOOAVSA-N |
| XLogP | 4.12 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|