C23H26N2O4 — CID 2434096
[(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 2434096) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 2434096 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | [(3E)-2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)OCC(=O)/C=C2/N(C)c3ccccc3C2(C)C)c1C |
| InChI | InChI=1S/C23H26N2O4/c1-13-20(15(3)26)14(2)24-21(13)22(28)29-12-16(27)11-19-23(4,5)17-9-7-8-10-18(17)25(19)6/h7-11,24H,12H2,1-6H3/b19-11+ |
| InChIKey | ZVCQXRIGACDTLS-YBFXNURJSA-N |
| XLogP | 3.87 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|