C24H23N3O4 — CID 3281235
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methyl-4-oxophthalazine-1-carboxylate (PubChem CID 3281235) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 3281235 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] 3-methyl-4-oxophthalazine-1-carboxylate |
| SMILES | CN1C(=CC(=O)COC(=O)c2nn(C)c(=O)c3ccccc23)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H23N3O4/c1-24(2)18-11-7-8-12-19(18)26(3)20(24)13-15(28)14-31-23(30)21-16-9-5-6-10-17(16)22(29)27(4)25-21/h5-13H,14H2,1-4H3 |
| InChIKey | PHKGSIUHWOCJPQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|