C20H20N2O3 — CID 7889710
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] pyridine-4-carboxylate (PubChem CID 7889710) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] pyridine-4-carboxylate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 7889710 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] pyridine-4-carboxylate |
| SMILES | CN1C(=CC(=O)COC(=O)c2ccncc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O3/c1-20(2)16-6-4-5-7-17(16)22(3)18(20)12-15(23)13-25-19(24)14-8-10-21-11-9-14/h4-12H,13H2,1-3H3 |
| InChIKey | VRSNQTMEUASCKR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|